C17H25N4O4S+ — CID 2672035
5,5-dimethyl-3-[[4-(4-methylphenyl)sulfonylpiperazin-1-ium-1-yl]methyl]imidazolidine-2,4-dione (PubChem CID 2672035) has the molecular formula C17H25N4O4S+ and a molecular weight of 381.48 g/mol. Its IUPAC name is 5,5-dimethyl-3-[[4-(4-methylphenyl)sulfonylpiperazin-1-ium-1-yl]methyl]imidazolidine-2,4-dione.
| Compound Name | 5,5-dimethyl-3-[[4-(4-methylphenyl)sulfonylpiperazin-1-ium-1-yl]methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 2672035 |
| Molecular Formula | C17H25N4O4S+ |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 5,5-dimethyl-3-[[4-(4-methylphenyl)sulfonylpiperazin-1-ium-1-yl]methyl]imidazolidine-2,4-dione |
| SMILES | Cc1ccc(S(=O)(=O)N2CC[NH+](CN3C(=O)NC(C)(C)C3=O)CC2)cc1 |
| InChI | InChI=1S/C17H24N4O4S/c1-13-4-6-14(7-5-13)26(24,25)20-10-8-19(9-11-20)12-21-15(22)17(2,3)18-16(21)23/h4-7H,8-12H2,1-3H3,(H,18,23)/p+1 |
| InChIKey | DUIZAGWOQJSVJB-UHFFFAOYSA-O |
| XLogP | -0.83 |
| TPSA | 91.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|