C22H25N5O6S — CID 42911148
5-methyl-5-(4-methylphenyl)-3-[[4-(4-nitrophenyl)sulfonylpiperazin-1-yl]methyl]imidazolidine-2,4-dione (PubChem CID 42911148) has the molecular formula C22H25N5O6S and a molecular weight of 487.54 g/mol. Its IUPAC name is 5-methyl-5-(4-methylphenyl)-3-[[4-(4-nitrophenyl)sulfonylpiperazin-1-yl]methyl]imidazolidine-2,4-dione.
| Compound Name | 5-methyl-5-(4-methylphenyl)-3-[[4-(4-nitrophenyl)sulfonylpiperazin-1-yl]methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 42911148 |
| Molecular Formula | C22H25N5O6S |
| Molecular Weight | 487.54 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | 5-methyl-5-(4-methylphenyl)-3-[[4-(4-nitrophenyl)sulfonylpiperazin-1-yl]methyl]imidazolidine-2,4-dione |
| SMILES | Cc1ccc(C2(C)NC(=O)N(CN3CCN(S(=O)(=O)c4ccc([N+](=O)[O-])cc4)CC3)C2=O)cc1 |
| InChI | InChI=1S/C22H25N5O6S/c1-16-3-5-17(6-4-16)22(2)20(28)26(21(29)23-22)15-24-11-13-25(14-12-24)34(32,33)19-9-7-18(8-10-19)27(30)31/h3-10H,11-15H2,1-2H3,(H,23,29) |
| InChIKey | YNKGUFQSXIKKPX-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 133.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.54 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|