C25H32N4O4S — CID 26008941
(5S)-5-methyl-3-[[4-(4-methylphenyl)sulfonyl-1,4-diazepan-1-yl]methyl]-5-(2-phenylethyl)imidazolidine-2,4-dione (PubChem CID 26008941) has the molecular formula C25H32N4O4S and a molecular weight of 484.62 g/mol. Its IUPAC name is (5S)-5-methyl-3-[[4-(4-methylphenyl)sulfonyl-1,4-diazepan-1-yl]methyl]-5-(2-phenylethyl)imidazolidine-2,4-dione.
| Compound Name | (5S)-5-methyl-3-[[4-(4-methylphenyl)sulfonyl-1,4-diazepan-1-yl]methyl]-5-(2-phenylethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 26008941 |
| Molecular Formula | C25H32N4O4S |
| Molecular Weight | 484.62 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | (5S)-5-methyl-3-[[4-(4-methylphenyl)sulfonyl-1,4-diazepan-1-yl]methyl]-5-(2-phenylethyl)imidazolidine-2,4-dione |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCN(CN3C(=O)N[C@@](C)(CCc4ccccc4)C3=O)CC2)cc1 |
| InChI | InChI=1S/C25H32N4O4S/c1-20-9-11-22(12-10-20)34(32,33)28-16-6-15-27(17-18-28)19-29-23(30)25(2,26-24(29)31)14-13-21-7-4-3-5-8-21/h3-5,7-12H,6,13-19H2,1-2H3,(H,26,31)/t25-/m0/s1 |
| InChIKey | SBAFVDWZQXMGFU-VWLOTQADSA-N |
| XLogP | 2.59 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.62 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|