C22H25FN4O4S — CID 31392589
(5R)-3-[[4-(4-fluorophenyl)sulfonyl-1,4-diazepan-1-yl]methyl]-5-methyl-5-phenylimidazolidine-2,4-dione (PubChem CID 31392589) has the molecular formula C22H25FN4O4S and a molecular weight of 460.53 g/mol. Its IUPAC name is (5R)-3-[[4-(4-fluorophenyl)sulfonyl-1,4-diazepan-1-yl]methyl]-5-methyl-5-phenylimidazolidine-2,4-dione.
| Compound Name | (5R)-3-[[4-(4-fluorophenyl)sulfonyl-1,4-diazepan-1-yl]methyl]-5-methyl-5-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 31392589 |
| Molecular Formula | C22H25FN4O4S |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | (5R)-3-[[4-(4-fluorophenyl)sulfonyl-1,4-diazepan-1-yl]methyl]-5-methyl-5-phenylimidazolidine-2,4-dione |
| SMILES | C[C@]1(c2ccccc2)NC(=O)N(CN2CCCN(S(=O)(=O)c3ccc(F)cc3)CC2)C1=O |
| InChI | InChI=1S/C22H25FN4O4S/c1-22(17-6-3-2-4-7-17)20(28)27(21(29)24-22)16-25-12-5-13-26(15-14-25)32(30,31)19-10-8-18(23)9-11-19/h2-4,6-11H,5,12-16H2,1H3,(H,24,29)/t22-/m1/s1 |
| InChIKey | VZSZJHKAUPRQPP-JOCHJYFZSA-N |
| XLogP | 1.95 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|