C25H30N4O5S — CID 41209789
4-methyl-N-[(4R)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-3-piperidin-1-ylsulfonylbenzamide (PubChem CID 41209789) has the molecular formula C25H30N4O5S and a molecular weight of 498.61 g/mol. Its IUPAC name is 4-methyl-N-[(4R)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-3-piperidin-1-ylsulfonylbenzamide.
| Compound Name | 4-methyl-N-[(4R)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-3-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 41209789 |
| Molecular Formula | C25H30N4O5S |
| Molecular Weight | 498.61 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | 4-methyl-N-[(4R)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-3-piperidin-1-ylsulfonylbenzamide |
| SMILES | Cc1ccc(C(=O)NN2C(=O)N[C@](C)(CCc3ccccc3)C2=O)cc1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C25H30N4O5S/c1-18-11-12-20(17-21(18)35(33,34)28-15-7-4-8-16-28)22(30)27-29-23(31)25(2,26-24(29)32)14-13-19-9-5-3-6-10-19/h3,5-6,9-12,17H,4,7-8,13-16H2,1-2H3,(H,26,32)(H,27,30)/t25-/m1/s1 |
| InChIKey | QAYSOPJKKXUSRT-RUZDIDTESA-N |
| XLogP | 2.76 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.61 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|