C23H24N4O3 — CID 31341167
2,3-dimethyl-N-[(4R)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-1H-indole-5-carboxamide (PubChem CID 31341167) has the molecular formula C23H24N4O3 and a molecular weight of 404.47 g/mol. Its IUPAC name is 2,3-dimethyl-N-[(4R)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-1H-indole-5-carboxamide.
| Compound Name | 2,3-dimethyl-N-[(4R)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 31341167 |
| Molecular Formula | C23H24N4O3 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 2,3-dimethyl-N-[(4R)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-1H-indole-5-carboxamide |
| SMILES | Cc1[nH]c2ccc(C(=O)NN3C(=O)N[C@](C)(CCc4ccccc4)C3=O)cc2c1C |
| InChI | InChI=1S/C23H24N4O3/c1-14-15(2)24-19-10-9-17(13-18(14)19)20(28)26-27-21(29)23(3,25-22(27)30)12-11-16-7-5-4-6-8-16/h4-10,13,24H,11-12H2,1-3H3,(H,25,30)(H,26,28)/t23-/m1/s1 |
| InChIKey | GOUQYVLCVDXXTK-HSZRJFAPSA-N |
| XLogP | 3.37 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|