C18H18N4O3 — CID 31434970
N-[(4R)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]pyridine-4-carboxamide (PubChem CID 31434970) has the molecular formula C18H18N4O3 and a molecular weight of 338.37 g/mol. Its IUPAC name is N-[(4R)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]pyridine-4-carboxamide.
| Compound Name | N-[(4R)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 31434970 |
| Molecular Formula | C18H18N4O3 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | N-[(4R)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]pyridine-4-carboxamide |
| SMILES | C[C@]1(CCc2ccccc2)NC(=O)N(NC(=O)c2ccncc2)C1=O |
| InChI | InChI=1S/C18H18N4O3/c1-18(10-7-13-5-3-2-4-6-13)16(24)22(17(25)20-18)21-15(23)14-8-11-19-12-9-14/h2-6,8-9,11-12H,7,10H2,1H3,(H,20,25)(H,21,23)/t18-/m1/s1 |
| InChIKey | JWEKBDZXBCBACL-GOSISDBHSA-N |
| XLogP | 1.67 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|