C21H19N5O4 — CID 9265772
N-[(4S)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-4-(1,3,4-oxadiazol-2-yl)benzamide (PubChem CID 9265772) has the molecular formula C21H19N5O4 and a molecular weight of 405.41 g/mol. Its IUPAC name is N-[(4S)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-4-(1,3,4-oxadiazol-2-yl)benzamide.
| Compound Name | N-[(4S)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-4-(1,3,4-oxadiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 9265772 |
| Molecular Formula | C21H19N5O4 |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | N-[(4S)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-4-(1,3,4-oxadiazol-2-yl)benzamide |
| SMILES | C[C@@]1(CCc2ccccc2)NC(=O)N(NC(=O)c2ccc(-c3nnco3)cc2)C1=O |
| InChI | InChI=1S/C21H19N5O4/c1-21(12-11-14-5-3-2-4-6-14)19(28)26(20(29)23-21)25-17(27)15-7-9-16(10-8-15)18-24-22-13-30-18/h2-10,13H,11-12H2,1H3,(H,23,29)(H,25,27)/t21-/m0/s1 |
| InChIKey | LXSKSLBVWUNQBP-NRFANRHFSA-N |
| XLogP | 2.32 |
| TPSA | 117.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|