C21H24N4O5S — CID 55440908
4-(ethylsulfamoyl)-N-[4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]benzamide (PubChem CID 55440908) has the molecular formula C21H24N4O5S and a molecular weight of 444.51 g/mol. Its IUPAC name is 4-(ethylsulfamoyl)-N-[4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]benzamide.
| Compound Name | 4-(ethylsulfamoyl)-N-[4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]benzamide |
|---|---|
| PubChem CID | 55440908 |
| Molecular Formula | C21H24N4O5S |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | 4-(ethylsulfamoyl)-N-[4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]benzamide |
| SMILES | CCNS(=O)(=O)c1ccc(C(=O)NN2C(=O)NC(C)(CCc3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C21H24N4O5S/c1-3-22-31(29,30)17-11-9-16(10-12-17)18(26)24-25-19(27)21(2,23-20(25)28)14-13-15-7-5-4-6-8-15/h4-12,22H,3,13-14H2,1-2H3,(H,23,28)(H,24,26) |
| InChIKey | OTJQNPQINMCHLW-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|