C20H21N3O5S — CID 42920186
N-[4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-3-methylsulfonylbenzamide (PubChem CID 42920186) has the molecular formula C20H21N3O5S and a molecular weight of 415.47 g/mol. Its IUPAC name is N-[4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-3-methylsulfonylbenzamide.
| Compound Name | N-[4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-3-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 42920186 |
| Molecular Formula | C20H21N3O5S |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | N-[4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-3-methylsulfonylbenzamide |
| SMILES | CC1(CCc2ccccc2)NC(=O)N(NC(=O)c2cccc(S(C)(=O)=O)c2)C1=O |
| InChI | InChI=1S/C20H21N3O5S/c1-20(12-11-14-7-4-3-5-8-14)18(25)23(19(26)21-20)22-17(24)15-9-6-10-16(13-15)29(2,27)28/h3-10,13H,11-12H2,1-2H3,(H,21,26)(H,22,24) |
| InChIKey | DXFPNUCYICOFGU-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|