C20H18N4O3 — CID 46655208
3-cyano-N-[4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]benzamide (PubChem CID 46655208) has the molecular formula C20H18N4O3 and a molecular weight of 362.39 g/mol. Its IUPAC name is 3-cyano-N-[4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]benzamide.
| Compound Name | 3-cyano-N-[4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]benzamide |
|---|---|
| PubChem CID | 46655208 |
| Molecular Formula | C20H18N4O3 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 3-cyano-N-[4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]benzamide |
| SMILES | CC1(CCc2ccccc2)NC(=O)N(NC(=O)c2cccc(C#N)c2)C1=O |
| InChI | InChI=1S/C20H18N4O3/c1-20(11-10-14-6-3-2-4-7-14)18(26)24(19(27)22-20)23-17(25)16-9-5-8-15(12-16)13-21/h2-9,12H,10-11H2,1H3,(H,22,27)(H,23,25) |
| InChIKey | XGEVHSLXAALBHZ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 102.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|