C22H23N3O3 — CID 31435973
N-[(4S)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-2,3-dihydro-1H-indene-5-carboxamide (PubChem CID 31435973) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is N-[(4S)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-2,3-dihydro-1H-indene-5-carboxamide.
| Compound Name | N-[(4S)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-2,3-dihydro-1H-indene-5-carboxamide |
|---|---|
| PubChem CID | 31435973 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | N-[(4S)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-2,3-dihydro-1H-indene-5-carboxamide |
| SMILES | C[C@@]1(CCc2ccccc2)NC(=O)N(NC(=O)c2ccc3c(c2)CCC3)C1=O |
| InChI | InChI=1S/C22H23N3O3/c1-22(13-12-15-6-3-2-4-7-15)20(27)25(21(28)23-22)24-19(26)18-11-10-16-8-5-9-17(16)14-18/h2-4,6-7,10-11,14H,5,8-9,12-13H2,1H3,(H,23,28)(H,24,26)/t22-/m0/s1 |
| InChIKey | TUFAOLQJRSCTIN-QFIPXVFZSA-N |
| XLogP | 2.76 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|