C27H25N5O4 — CID 41082917
4-(imidazo[1,2-a]pyridin-2-ylmethoxy)-N-[(4S)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]benzamide (PubChem CID 41082917) has the molecular formula C27H25N5O4 and a molecular weight of 483.53 g/mol. Its IUPAC name is 4-(imidazo[1,2-a]pyridin-2-ylmethoxy)-N-[(4S)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]benzamide.
| Compound Name | 4-(imidazo[1,2-a]pyridin-2-ylmethoxy)-N-[(4S)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]benzamide |
|---|---|
| PubChem CID | 41082917 |
| Molecular Formula | C27H25N5O4 |
| Molecular Weight | 483.53 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | 4-(imidazo[1,2-a]pyridin-2-ylmethoxy)-N-[(4S)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]benzamide |
| SMILES | C[C@@]1(CCc2ccccc2)NC(=O)N(NC(=O)c2ccc(OCc3cn4ccccc4n3)cc2)C1=O |
| InChI | InChI=1S/C27H25N5O4/c1-27(15-14-19-7-3-2-4-8-19)25(34)32(26(35)29-27)30-24(33)20-10-12-22(13-11-20)36-18-21-17-31-16-6-5-9-23(31)28-21/h2-13,16-17H,14-15,18H2,1H3,(H,29,35)(H,30,33)/t27-/m0/s1 |
| InChIKey | RTCFGPYJPPBPGO-MHZLTWQESA-N |
| XLogP | 3.50 |
| TPSA | 105.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.53 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|