C24H24N4O4S — CID 41188420
N-[(4R)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-4-[(2-methyl-1,3-thiazol-4-yl)methoxy]benzamide (PubChem CID 41188420) has the molecular formula C24H24N4O4S and a molecular weight of 464.55 g/mol. Its IUPAC name is N-[(4R)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-4-[(2-methyl-1,3-thiazol-4-yl)methoxy]benzamide.
| Compound Name | N-[(4R)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-4-[(2-methyl-1,3-thiazol-4-yl)methoxy]benzamide |
|---|---|
| PubChem CID | 41188420 |
| Molecular Formula | C24H24N4O4S |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | N-[(4R)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-4-[(2-methyl-1,3-thiazol-4-yl)methoxy]benzamide |
| SMILES | Cc1nc(COc2ccc(C(=O)NN3C(=O)N[C@](C)(CCc4ccccc4)C3=O)cc2)cs1 |
| InChI | InChI=1S/C24H24N4O4S/c1-16-25-19(15-33-16)14-32-20-10-8-18(9-11-20)21(29)27-28-22(30)24(2,26-23(28)31)13-12-17-6-4-3-5-7-17/h3-11,15H,12-14H2,1-2H3,(H,26,31)(H,27,29)/t24-/m1/s1 |
| InChIKey | TVOGTLKZIYPTDK-XMMPIXPASA-N |
| XLogP | 3.62 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|