C19H18N2O2S — CID 9043200
N-benzyl-4-[(2-methyl-1,3-thiazol-4-yl)methoxy]benzamide (PubChem CID 9043200) has the molecular formula C19H18N2O2S and a molecular weight of 338.43 g/mol. Its IUPAC name is N-benzyl-4-[(2-methyl-1,3-thiazol-4-yl)methoxy]benzamide.
| Compound Name | N-benzyl-4-[(2-methyl-1,3-thiazol-4-yl)methoxy]benzamide |
|---|---|
| PubChem CID | 9043200 |
| Molecular Formula | C19H18N2O2S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | N-benzyl-4-[(2-methyl-1,3-thiazol-4-yl)methoxy]benzamide |
| SMILES | Cc1nc(COc2ccc(C(=O)NCc3ccccc3)cc2)cs1 |
| InChI | InChI=1S/C19H18N2O2S/c1-14-21-17(13-24-14)12-23-18-9-7-16(8-10-18)19(22)20-11-15-5-3-2-4-6-15/h2-10,13H,11-12H2,1H3,(H,20,22) |
| InChIKey | DCTPSUWIDJUPQN-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |