C20H18N4O3S2 — CID 92786925
N-[(4R)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-2-thiophen-3-yl-1,3-thiazole-4-carboxamide (PubChem CID 92786925) has the molecular formula C20H18N4O3S2 and a molecular weight of 426.52 g/mol. Its IUPAC name is N-[(4R)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-2-thiophen-3-yl-1,3-thiazole-4-carboxamide.
| Compound Name | N-[(4R)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-2-thiophen-3-yl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 92786925 |
| Molecular Formula | C20H18N4O3S2 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.08 |
| IUPAC Name | N-[(4R)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]-2-thiophen-3-yl-1,3-thiazole-4-carboxamide |
| SMILES | C[C@]1(CCc2ccccc2)NC(=O)N(NC(=O)c2csc(-c3ccsc3)n2)C1=O |
| InChI | InChI=1S/C20H18N4O3S2/c1-20(9-7-13-5-3-2-4-6-13)18(26)24(19(27)22-20)23-16(25)15-12-29-17(21-15)14-8-10-28-11-14/h2-6,8,10-12H,7,9H2,1H3,(H,22,27)(H,23,25)/t20-/m1/s1 |
| InChIKey | UKLKDXBGQKIKCS-HXUWFJFHSA-N |
| XLogP | 3.46 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|