C22H22N4O4S — CID 41253517
2-(1,3-benzothiazol-2-ylmethoxy)-N-[(4R)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]acetamide (PubChem CID 41253517) has the molecular formula C22H22N4O4S and a molecular weight of 438.51 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylmethoxy)-N-[(4R)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]acetamide.
| Compound Name | 2-(1,3-benzothiazol-2-ylmethoxy)-N-[(4R)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 41253517 |
| Molecular Formula | C22H22N4O4S |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylmethoxy)-N-[(4R)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]acetamide |
| SMILES | C[C@]1(CCc2ccccc2)NC(=O)N(NC(=O)COCc2nc3ccccc3s2)C1=O |
| InChI | InChI=1S/C22H22N4O4S/c1-22(12-11-15-7-3-2-4-8-15)20(28)26(21(29)24-22)25-18(27)13-30-14-19-23-16-9-5-6-10-17(16)31-19/h2-10H,11-14H2,1H3,(H,24,29)(H,25,27)/t22-/m1/s1 |
| InChIKey | LFNKVWJJZZIJET-JOCHJYFZSA-N |
| XLogP | 2.79 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|