C18H23N3O6 — CID 9289686
[2-[[(4R)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]amino]-2-oxoethyl] 2-ethoxyacetate (PubChem CID 9289686) has the molecular formula C18H23N3O6 and a molecular weight of 377.40 g/mol. Its IUPAC name is [2-[[(4R)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]amino]-2-oxoethyl] 2-ethoxyacetate.
| Compound Name | [2-[[(4R)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]amino]-2-oxoethyl] 2-ethoxyacetate |
|---|---|
| PubChem CID | 9289686 |
| Molecular Formula | C18H23N3O6 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | [2-[[(4R)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]amino]-2-oxoethyl] 2-ethoxyacetate |
| SMILES | CCOCC(=O)OCC(=O)NN1C(=O)N[C@](C)(CCc2ccccc2)C1=O |
| InChI | InChI=1S/C18H23N3O6/c1-3-26-12-15(23)27-11-14(22)20-21-16(24)18(2,19-17(21)25)10-9-13-7-5-4-6-8-13/h4-8H,3,9-12H2,1-2H3,(H,19,25)(H,20,22)/t18-/m1/s1 |
| InChIKey | VJHCIWOTNCOXAJ-GOSISDBHSA-N |
| XLogP | 0.54 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|