C22H23N3O5 — CID 9018249
[2-[[(4S)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]amino]-2-oxoethyl] 4-methylbenzoate (PubChem CID 9018249) has the molecular formula C22H23N3O5 and a molecular weight of 409.44 g/mol. Its IUPAC name is [2-[[(4S)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]amino]-2-oxoethyl] 4-methylbenzoate.
| Compound Name | [2-[[(4S)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]amino]-2-oxoethyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 9018249 |
| Molecular Formula | C22H23N3O5 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | [2-[[(4S)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]amino]-2-oxoethyl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OCC(=O)NN2C(=O)N[C@@](C)(CCc3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C22H23N3O5/c1-15-8-10-17(11-9-15)19(27)30-14-18(26)24-25-20(28)22(2,23-21(25)29)13-12-16-6-4-3-5-7-16/h3-11H,12-14H2,1-2H3,(H,23,29)(H,24,26)/t22-/m0/s1 |
| InChIKey | BWBIYHRBJDOWFY-QFIPXVFZSA-N |
| XLogP | 2.13 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|