C18H23ClN4O5S — CID 41095890
4-chloro-N-[(4S)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]-3-piperidin-1-ylsulfonylbenzamide (PubChem CID 41095890) has the molecular formula C18H23ClN4O5S and a molecular weight of 442.93 g/mol. Its IUPAC name is 4-chloro-N-[(4S)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]-3-piperidin-1-ylsulfonylbenzamide.
| Compound Name | 4-chloro-N-[(4S)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]-3-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 41095890 |
| Molecular Formula | C18H23ClN4O5S |
| Molecular Weight | 442.93 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | 4-chloro-N-[(4S)-4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]-3-piperidin-1-ylsulfonylbenzamide |
| SMILES | CC[C@]1(C)NC(=O)N(NC(=O)c2ccc(Cl)c(S(=O)(=O)N3CCCCC3)c2)C1=O |
| InChI | InChI=1S/C18H23ClN4O5S/c1-3-18(2)16(25)23(17(26)20-18)21-15(24)12-7-8-13(19)14(11-12)29(27,28)22-9-5-4-6-10-22/h7-8,11H,3-6,9-10H2,1-2H3,(H,20,26)(H,21,24)/t18-/m0/s1 |
| InChIKey | OKJUAZJJFRABKT-SFHVURJKSA-N |
| XLogP | 1.88 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.93 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|