C19H23N5O7S — CID 4858215
1-cyclopentyl-3-[[4-(4-nitrophenyl)sulfonylpiperazin-1-yl]methyl]imidazolidine-2,4,5-trione (PubChem CID 4858215) has the molecular formula C19H23N5O7S and a molecular weight of 465.49 g/mol. Its IUPAC name is 1-cyclopentyl-3-[[4-(4-nitrophenyl)sulfonylpiperazin-1-yl]methyl]imidazolidine-2,4,5-trione.
| Compound Name | 1-cyclopentyl-3-[[4-(4-nitrophenyl)sulfonylpiperazin-1-yl]methyl]imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 4858215 |
| Molecular Formula | C19H23N5O7S |
| Molecular Weight | 465.49 g/mol |
| Exact Mass | 465.13 |
| IUPAC Name | 1-cyclopentyl-3-[[4-(4-nitrophenyl)sulfonylpiperazin-1-yl]methyl]imidazolidine-2,4,5-trione |
| SMILES | O=C1C(=O)N(C2CCCC2)C(=O)N1CN1CCN(S(=O)(=O)c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C19H23N5O7S/c25-17-18(26)23(14-3-1-2-4-14)19(27)22(17)13-20-9-11-21(12-10-20)32(30,31)16-7-5-15(6-8-16)24(28)29/h5-8,14H,1-4,9-13H2 |
| InChIKey | PDSBATLIAZEQRF-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 141.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.49 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|