C17H24N4O7S2 — CID 24583608
(1-methylsulfonylpiperidin-2-yl)-[4-(4-nitrophenyl)sulfonylpiperazin-1-yl]methanone (PubChem CID 24583608) has the molecular formula C17H24N4O7S2 and a molecular weight of 460.53 g/mol. Its IUPAC name is (1-methylsulfonylpiperidin-2-yl)-[4-(4-nitrophenyl)sulfonylpiperazin-1-yl]methanone.
| Compound Name | (1-methylsulfonylpiperidin-2-yl)-[4-(4-nitrophenyl)sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 24583608 |
| Molecular Formula | C17H24N4O7S2 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.11 |
| IUPAC Name | (1-methylsulfonylpiperidin-2-yl)-[4-(4-nitrophenyl)sulfonylpiperazin-1-yl]methanone |
| SMILES | CS(=O)(=O)N1CCCCC1C(=O)N1CCN(S(=O)(=O)c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C17H24N4O7S2/c1-29(25,26)20-9-3-2-4-16(20)17(22)18-10-12-19(13-11-18)30(27,28)15-7-5-14(6-8-15)21(23)24/h5-8,16H,2-4,9-13H2,1H3 |
| InChIKey | MIZPZXVPOGDJLH-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 138.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|