C15H20N2O5S2 — CID 110817571
cyclopropyl-[4-(4-methylsulfonylphenyl)sulfonylpiperazin-1-yl]methanone (PubChem CID 110817571) has the molecular formula C15H20N2O5S2 and a molecular weight of 372.47 g/mol. Its IUPAC name is cyclopropyl-[4-(4-methylsulfonylphenyl)sulfonylpiperazin-1-yl]methanone.
| Compound Name | cyclopropyl-[4-(4-methylsulfonylphenyl)sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 110817571 |
| Molecular Formula | C15H20N2O5S2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | cyclopropyl-[4-(4-methylsulfonylphenyl)sulfonylpiperazin-1-yl]methanone |
| SMILES | CS(=O)(=O)c1ccc(S(=O)(=O)N2CCN(C(=O)C3CC3)CC2)cc1 |
| InChI | InChI=1S/C15H20N2O5S2/c1-23(19,20)13-4-6-14(7-5-13)24(21,22)17-10-8-16(9-11-17)15(18)12-2-3-12/h4-7,12H,2-3,8-11H2,1H3 |
| InChIKey | GJLVSAJTGLMQQM-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |