C19H28N2O5S2 — CID 55853869
cyclohexyl-[4-(2-methyl-5-methylsulfonylphenyl)sulfonylpiperazin-1-yl]methanone (PubChem CID 55853869) has the molecular formula C19H28N2O5S2 and a molecular weight of 428.58 g/mol. Its IUPAC name is cyclohexyl-[4-(2-methyl-5-methylsulfonylphenyl)sulfonylpiperazin-1-yl]methanone.
| Compound Name | cyclohexyl-[4-(2-methyl-5-methylsulfonylphenyl)sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 55853869 |
| Molecular Formula | C19H28N2O5S2 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | cyclohexyl-[4-(2-methyl-5-methylsulfonylphenyl)sulfonylpiperazin-1-yl]methanone |
| SMILES | Cc1ccc(S(C)(=O)=O)cc1S(=O)(=O)N1CCN(C(=O)C2CCCCC2)CC1 |
| InChI | InChI=1S/C19H28N2O5S2/c1-15-8-9-17(27(2,23)24)14-18(15)28(25,26)21-12-10-20(11-13-21)19(22)16-6-4-3-5-7-16/h8-9,14,16H,3-7,10-13H2,1-2H3 |
| InChIKey | GYHRHNTWBXLZNO-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |