C17H23BrN2O3S — CID 8699978
[4-(4-bromo-3-methylphenyl)sulfonylpiperazin-1-yl]-cyclopentylmethanone (PubChem CID 8699978) has the molecular formula C17H23BrN2O3S and a molecular weight of 415.35 g/mol. Its IUPAC name is [4-(4-bromo-3-methylphenyl)sulfonylpiperazin-1-yl]-cyclopentylmethanone.
| Compound Name | [4-(4-bromo-3-methylphenyl)sulfonylpiperazin-1-yl]-cyclopentylmethanone |
|---|---|
| PubChem CID | 8699978 |
| Molecular Formula | C17H23BrN2O3S |
| Molecular Weight | 415.35 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | [4-(4-bromo-3-methylphenyl)sulfonylpiperazin-1-yl]-cyclopentylmethanone |
| SMILES | Cc1cc(S(=O)(=O)N2CCN(C(=O)C3CCCC3)CC2)ccc1Br |
| InChI | InChI=1S/C17H23BrN2O3S/c1-13-12-15(6-7-16(13)18)24(22,23)20-10-8-19(9-11-20)17(21)14-4-2-3-5-14/h6-7,12,14H,2-5,8-11H2,1H3 |
| InChIKey | SRDQUXFWKNKDIM-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.35 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |