C19H28N2O3S — CID 49457529
[1-(2,5-dimethylphenyl)sulfonylpiperidin-3-yl]-piperidin-1-ylmethanone (PubChem CID 49457529) has the molecular formula C19H28N2O3S and a molecular weight of 364.51 g/mol. Its IUPAC name is [1-(2,5-dimethylphenyl)sulfonylpiperidin-3-yl]-piperidin-1-ylmethanone.
| Compound Name | [1-(2,5-dimethylphenyl)sulfonylpiperidin-3-yl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 49457529 |
| Molecular Formula | C19H28N2O3S |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | [1-(2,5-dimethylphenyl)sulfonylpiperidin-3-yl]-piperidin-1-ylmethanone |
| SMILES | Cc1ccc(C)c(S(=O)(=O)N2CCCC(C(=O)N3CCCCC3)C2)c1 |
| InChI | InChI=1S/C19H28N2O3S/c1-15-8-9-16(2)18(13-15)25(23,24)21-12-6-7-17(14-21)19(22)20-10-4-3-5-11-20/h8-9,13,17H,3-7,10-12,14H2,1-2H3 |
| InChIKey | RDGQAWWJRSCZQN-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |