C17H26N2O3S — CID 94381355
(3R)-1-(2,5-dimethylphenyl)sulfonyl-N-propylpiperidine-3-carboxamide (PubChem CID 94381355) has the molecular formula C17H26N2O3S and a molecular weight of 338.47 g/mol. Its IUPAC name is (3R)-1-(2,5-dimethylphenyl)sulfonyl-N-propylpiperidine-3-carboxamide.
| Compound Name | (3R)-1-(2,5-dimethylphenyl)sulfonyl-N-propylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 94381355 |
| Molecular Formula | C17H26N2O3S |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | (3R)-1-(2,5-dimethylphenyl)sulfonyl-N-propylpiperidine-3-carboxamide |
| SMILES | CCCNC(=O)[C@@H]1CCCN(S(=O)(=O)c2cc(C)ccc2C)C1 |
| InChI | InChI=1S/C17H26N2O3S/c1-4-9-18-17(20)15-6-5-10-19(12-15)23(21,22)16-11-13(2)7-8-14(16)3/h7-8,11,15H,4-6,9-10,12H2,1-3H3,(H,18,20)/t15-/m1/s1 |
| InChIKey | CYZDHQLPZQMWRN-OAHLLOKOSA-N |
| XLogP | 2.23 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |