C22H28N2O3S — CID 133254940
N-(3,4-dimethylphenyl)-1-(2,5-dimethylphenyl)sulfonylpiperidine-3-carboxamide (PubChem CID 133254940) has the molecular formula C22H28N2O3S and a molecular weight of 400.54 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-1-(2,5-dimethylphenyl)sulfonylpiperidine-3-carboxamide.
| Compound Name | N-(3,4-dimethylphenyl)-1-(2,5-dimethylphenyl)sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 133254940 |
| Molecular Formula | C22H28N2O3S |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | N-(3,4-dimethylphenyl)-1-(2,5-dimethylphenyl)sulfonylpiperidine-3-carboxamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)N2CCCC(C(=O)Nc3ccc(C)c(C)c3)C2)c1 |
| InChI | InChI=1S/C22H28N2O3S/c1-15-7-8-17(3)21(12-15)28(26,27)24-11-5-6-19(14-24)22(25)23-20-10-9-16(2)18(4)13-20/h7-10,12-13,19H,5-6,11,14H2,1-4H3,(H,23,25) |
| InChIKey | RLLCYBFFQDVRAO-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |