C20H23BrN2O3S — CID 133254953
N-(4-bromophenyl)-1-(2,5-dimethylphenyl)sulfonylpiperidine-3-carboxamide (PubChem CID 133254953) has the molecular formula C20H23BrN2O3S and a molecular weight of 451.39 g/mol. Its IUPAC name is N-(4-bromophenyl)-1-(2,5-dimethylphenyl)sulfonylpiperidine-3-carboxamide.
| Compound Name | N-(4-bromophenyl)-1-(2,5-dimethylphenyl)sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 133254953 |
| Molecular Formula | C20H23BrN2O3S |
| Molecular Weight | 451.39 g/mol |
| Exact Mass | 450.06 |
| IUPAC Name | N-(4-bromophenyl)-1-(2,5-dimethylphenyl)sulfonylpiperidine-3-carboxamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)N2CCCC(C(=O)Nc3ccc(Br)cc3)C2)c1 |
| InChI | InChI=1S/C20H23BrN2O3S/c1-14-5-6-15(2)19(12-14)27(25,26)23-11-3-4-16(13-23)20(24)22-18-9-7-17(21)8-10-18/h5-10,12,16H,3-4,11,13H2,1-2H3,(H,22,24) |
| InChIKey | KOASGTZKPGSXMC-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.39 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |