C15H25N2O2S+ — CID 6944872
1-[(2S)-butan-2-yl]-4-(4-methylphenyl)sulfonylpiperazin-1-ium (PubChem CID 6944872) has the molecular formula C15H25N2O2S+ and a molecular weight of 297.44 g/mol. Its IUPAC name is 1-[(2S)-butan-2-yl]-4-(4-methylphenyl)sulfonylpiperazin-1-ium.
| Compound Name | 1-[(2S)-butan-2-yl]-4-(4-methylphenyl)sulfonylpiperazin-1-ium |
|---|---|
| PubChem CID | 6944872 |
| Molecular Formula | C15H25N2O2S+ |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | 1-[(2S)-butan-2-yl]-4-(4-methylphenyl)sulfonylpiperazin-1-ium |
| SMILES | CC[C@H](C)[NH+]1CCN(S(=O)(=O)c2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C15H24N2O2S/c1-4-14(3)16-9-11-17(12-10-16)20(18,19)15-7-5-13(2)6-8-15/h5-8,14H,4,9-12H2,1-3H3/p+1/t14-/m0/s1 |
| InChIKey | QRNNKEGSWLHGCA-AWEZNQCLSA-O |
| XLogP | 0.68 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |