C14H23N2O2S+ — CID 6948505
1-(benzenesulfonyl)-4-[(2S)-butan-2-yl]piperazin-4-ium (PubChem CID 6948505) has the molecular formula C14H23N2O2S+ and a molecular weight of 283.42 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-4-[(2S)-butan-2-yl]piperazin-4-ium.
| Compound Name | 1-(benzenesulfonyl)-4-[(2S)-butan-2-yl]piperazin-4-ium |
|---|---|
| PubChem CID | 6948505 |
| Molecular Formula | C14H23N2O2S+ |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | 1-(benzenesulfonyl)-4-[(2S)-butan-2-yl]piperazin-4-ium |
| SMILES | CC[C@H](C)[NH+]1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C14H22N2O2S/c1-3-13(2)15-9-11-16(12-10-15)19(17,18)14-7-5-4-6-8-14/h4-8,13H,3,9-12H2,1-2H3/p+1/t13-/m0/s1 |
| InChIKey | JYZVPFFSZOGXED-ZDUSSCGKSA-O |
| XLogP | 0.37 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |