C20H27N2O2S+ — CID 6971223
1-(benzenesulfonyl)-4-[(2S)-4-phenylbutan-2-yl]piperazin-4-ium (PubChem CID 6971223) has the molecular formula C20H27N2O2S+ and a molecular weight of 359.51 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-4-[(2S)-4-phenylbutan-2-yl]piperazin-4-ium.
| Compound Name | 1-(benzenesulfonyl)-4-[(2S)-4-phenylbutan-2-yl]piperazin-4-ium |
|---|---|
| PubChem CID | 6971223 |
| Molecular Formula | C20H27N2O2S+ |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | 1-(benzenesulfonyl)-4-[(2S)-4-phenylbutan-2-yl]piperazin-4-ium |
| SMILES | C[C@@H](CCc1ccccc1)[NH+]1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C20H26N2O2S/c1-18(12-13-19-8-4-2-5-9-19)21-14-16-22(17-15-21)25(23,24)20-10-6-3-7-11-20/h2-11,18H,12-17H2,1H3/p+1/t18-/m0/s1 |
| InChIKey | XRZYJEGZRBPKHL-SFHVURJKSA-O |
| XLogP | 1.60 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |