C20H26ClN2O2S+ — CID 7325620
1-(4-chlorophenyl)sulfonyl-4-[(2S)-4-phenylbutan-2-yl]piperazin-4-ium (PubChem CID 7325620) has the molecular formula C20H26ClN2O2S+ and a molecular weight of 393.96 g/mol. Its IUPAC name is 1-(4-chlorophenyl)sulfonyl-4-[(2S)-4-phenylbutan-2-yl]piperazin-4-ium.
| Compound Name | 1-(4-chlorophenyl)sulfonyl-4-[(2S)-4-phenylbutan-2-yl]piperazin-4-ium |
|---|---|
| PubChem CID | 7325620 |
| Molecular Formula | C20H26ClN2O2S+ |
| Molecular Weight | 393.96 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 1-(4-chlorophenyl)sulfonyl-4-[(2S)-4-phenylbutan-2-yl]piperazin-4-ium |
| SMILES | C[C@@H](CCc1ccccc1)[NH+]1CCN(S(=O)(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C20H25ClN2O2S/c1-17(7-8-18-5-3-2-4-6-18)22-13-15-23(16-14-22)26(24,25)20-11-9-19(21)10-12-20/h2-6,9-12,17H,7-8,13-16H2,1H3/p+1/t17-/m0/s1 |
| InChIKey | SBELNCDVOOOJFD-KRWDZBQOSA-O |
| XLogP | 2.25 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.96 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |