C19H22ClFN3O3S+ — CID 2524818
(2R)-2-[4-(4-chlorophenyl)sulfonylpiperazin-1-ium-1-yl]-N-(2-fluorophenyl)propanamide (PubChem CID 2524818) has the molecular formula C19H22ClFN3O3S+ and a molecular weight of 426.92 g/mol. Its IUPAC name is (2R)-2-[4-(4-chlorophenyl)sulfonylpiperazin-1-ium-1-yl]-N-(2-fluorophenyl)propanamide.
| Compound Name | (2R)-2-[4-(4-chlorophenyl)sulfonylpiperazin-1-ium-1-yl]-N-(2-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 2524818 |
| Molecular Formula | C19H22ClFN3O3S+ |
| Molecular Weight | 426.92 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | (2R)-2-[4-(4-chlorophenyl)sulfonylpiperazin-1-ium-1-yl]-N-(2-fluorophenyl)propanamide |
| SMILES | C[C@H](C(=O)Nc1ccccc1F)[NH+]1CCN(S(=O)(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C19H21ClFN3O3S/c1-14(19(25)22-18-5-3-2-4-17(18)21)23-10-12-24(13-11-23)28(26,27)16-8-6-15(20)7-9-16/h2-9,14H,10-13H2,1H3,(H,22,25)/p+1/t14-/m1/s1 |
| InChIKey | FUCHKCSCJOPVTC-CQSZACIVSA-O |
| XLogP | 1.40 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.92 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |