C25H29N2O2S+ — CID 6960382
1-benzhydryl-4-(4-ethylphenyl)sulfonylpiperazin-1-ium (PubChem CID 6960382) has the molecular formula C25H29N2O2S+ and a molecular weight of 421.59 g/mol. Its IUPAC name is 1-benzhydryl-4-(4-ethylphenyl)sulfonylpiperazin-1-ium.
| Compound Name | 1-benzhydryl-4-(4-ethylphenyl)sulfonylpiperazin-1-ium |
|---|---|
| PubChem CID | 6960382 |
| Molecular Formula | C25H29N2O2S+ |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | 1-benzhydryl-4-(4-ethylphenyl)sulfonylpiperazin-1-ium |
| SMILES | CCc1ccc(S(=O)(=O)N2CC[NH+](C(c3ccccc3)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C25H28N2O2S/c1-2-21-13-15-24(16-14-21)30(28,29)27-19-17-26(18-20-27)25(22-9-5-3-6-10-22)23-11-7-4-8-12-23/h3-16,25H,2,17-20H2,1H3/p+1 |
| InChIKey | FRZDEVPIEHKPKO-UHFFFAOYSA-O |
| XLogP | 2.93 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |