C25H29N2O2S+ — CID 4558812
1-benzhydryl-4-(3,4-dimethylphenyl)sulfonylpiperazin-1-ium (PubChem CID 4558812) has the molecular formula C25H29N2O2S+ and a molecular weight of 421.59 g/mol. Its IUPAC name is 1-benzhydryl-4-(3,4-dimethylphenyl)sulfonylpiperazin-1-ium.
| Compound Name | 1-benzhydryl-4-(3,4-dimethylphenyl)sulfonylpiperazin-1-ium |
|---|---|
| PubChem CID | 4558812 |
| Molecular Formula | C25H29N2O2S+ |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | 1-benzhydryl-4-(3,4-dimethylphenyl)sulfonylpiperazin-1-ium |
| SMILES | Cc1ccc(S(=O)(=O)N2CC[NH+](C(c3ccccc3)c3ccccc3)CC2)cc1C |
| InChI | InChI=1S/C25H28N2O2S/c1-20-13-14-24(19-21(20)2)30(28,29)27-17-15-26(16-18-27)25(22-9-5-3-6-10-22)23-11-7-4-8-12-23/h3-14,19,25H,15-18H2,1-2H3/p+1 |
| InChIKey | ZQEYQUIHJYHNLC-UHFFFAOYSA-O |
| XLogP | 2.98 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |