C21H28N3O3S+ — CID 2656181
(2S)-2-[4-(3,4-dimethylphenyl)sulfonylpiperazin-1-ium-1-yl]-N-phenylpropanamide (PubChem CID 2656181) has the molecular formula C21H28N3O3S+ and a molecular weight of 402.54 g/mol. Its IUPAC name is (2S)-2-[4-(3,4-dimethylphenyl)sulfonylpiperazin-1-ium-1-yl]-N-phenylpropanamide.
| Compound Name | (2S)-2-[4-(3,4-dimethylphenyl)sulfonylpiperazin-1-ium-1-yl]-N-phenylpropanamide |
|---|---|
| PubChem CID | 2656181 |
| Molecular Formula | C21H28N3O3S+ |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | (2S)-2-[4-(3,4-dimethylphenyl)sulfonylpiperazin-1-ium-1-yl]-N-phenylpropanamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CC[NH+]([C@@H](C)C(=O)Nc3ccccc3)CC2)cc1C |
| InChI | InChI=1S/C21H27N3O3S/c1-16-9-10-20(15-17(16)2)28(26,27)24-13-11-23(12-14-24)18(3)21(25)22-19-7-5-4-6-8-19/h4-10,15,18H,11-14H2,1-3H3,(H,22,25)/p+1/t18-/m0/s1 |
| InChIKey | FHDCKMQHDRVTAX-SFHVURJKSA-O |
| XLogP | 1.22 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |