C19H25N2O2S+ — CID 4743473
1-(benzenesulfonyl)-4-[(4-ethylphenyl)methyl]piperazin-4-ium (PubChem CID 4743473) has the molecular formula C19H25N2O2S+ and a molecular weight of 345.49 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-4-[(4-ethylphenyl)methyl]piperazin-4-ium.
| Compound Name | 1-(benzenesulfonyl)-4-[(4-ethylphenyl)methyl]piperazin-4-ium |
|---|---|
| PubChem CID | 4743473 |
| Molecular Formula | C19H25N2O2S+ |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 1-(benzenesulfonyl)-4-[(4-ethylphenyl)methyl]piperazin-4-ium |
| SMILES | CCc1ccc(C[NH+]2CCN(S(=O)(=O)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C19H24N2O2S/c1-2-17-8-10-18(11-9-17)16-20-12-14-21(15-13-20)24(22,23)19-6-4-3-5-7-19/h3-11H,2,12-16H2,1H3/p+1 |
| InChIKey | PEFHQVFUEDFQCD-UHFFFAOYSA-O |
| XLogP | 1.34 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |