C18H22BrN2O2S+ — CID 9025393
1-(3-bromophenyl)sulfonyl-4-[(4-methylphenyl)methyl]piperazin-4-ium (PubChem CID 9025393) has the molecular formula C18H22BrN2O2S+ and a molecular weight of 410.36 g/mol. Its IUPAC name is 1-(3-bromophenyl)sulfonyl-4-[(4-methylphenyl)methyl]piperazin-4-ium.
| Compound Name | 1-(3-bromophenyl)sulfonyl-4-[(4-methylphenyl)methyl]piperazin-4-ium |
|---|---|
| PubChem CID | 9025393 |
| Molecular Formula | C18H22BrN2O2S+ |
| Molecular Weight | 410.36 g/mol |
| Exact Mass | 409.06 |
| IUPAC Name | 1-(3-bromophenyl)sulfonyl-4-[(4-methylphenyl)methyl]piperazin-4-ium |
| SMILES | Cc1ccc(C[NH+]2CCN(S(=O)(=O)c3cccc(Br)c3)CC2)cc1 |
| InChI | InChI=1S/C18H21BrN2O2S/c1-15-5-7-16(8-6-15)14-20-9-11-21(12-10-20)24(22,23)18-4-2-3-17(19)13-18/h2-8,13H,9-12,14H2,1H3/p+1 |
| InChIKey | FJFWKJWHJJJKMO-UHFFFAOYSA-O |
| XLogP | 1.85 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.36 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |