C17H19BrN2O4S2 — CID 26947059
1-benzylsulfonyl-4-(3-bromophenyl)sulfonylpiperazine (PubChem CID 26947059) has the molecular formula C17H19BrN2O4S2 and a molecular weight of 459.39 g/mol. Its IUPAC name is 1-benzylsulfonyl-4-(3-bromophenyl)sulfonylpiperazine.
| Compound Name | 1-benzylsulfonyl-4-(3-bromophenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 26947059 |
| Molecular Formula | C17H19BrN2O4S2 |
| Molecular Weight | 459.39 g/mol |
| Exact Mass | 458.00 |
| IUPAC Name | 1-benzylsulfonyl-4-(3-bromophenyl)sulfonylpiperazine |
| SMILES | O=S(=O)(Cc1ccccc1)N1CCN(S(=O)(=O)c2cccc(Br)c2)CC1 |
| InChI | InChI=1S/C17H19BrN2O4S2/c18-16-7-4-8-17(13-16)26(23,24)20-11-9-19(10-12-20)25(21,22)14-15-5-2-1-3-6-15/h1-8,13H,9-12,14H2 |
| InChIKey | CJQFHGAGFKZWSX-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.39 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |