C18H18BrN3O2S — CID 112799273
2-[4-(3-bromophenyl)sulfonylpiperazin-1-yl]-2-phenylacetonitrile (PubChem CID 112799273) has the molecular formula C18H18BrN3O2S and a molecular weight of 420.33 g/mol. Its IUPAC name is 2-[4-(3-bromophenyl)sulfonylpiperazin-1-yl]-2-phenylacetonitrile.
| Compound Name | 2-[4-(3-bromophenyl)sulfonylpiperazin-1-yl]-2-phenylacetonitrile |
|---|---|
| PubChem CID | 112799273 |
| Molecular Formula | C18H18BrN3O2S |
| Molecular Weight | 420.33 g/mol |
| Exact Mass | 419.03 |
| IUPAC Name | 2-[4-(3-bromophenyl)sulfonylpiperazin-1-yl]-2-phenylacetonitrile |
| SMILES | N#CC(c1ccccc1)N1CCN(S(=O)(=O)c2cccc(Br)c2)CC1 |
| InChI | InChI=1S/C18H18BrN3O2S/c19-16-7-4-8-17(13-16)25(23,24)22-11-9-21(10-12-22)18(14-20)15-5-2-1-3-6-15/h1-8,13,18H,9-12H2 |
| InChIKey | QCLFUWBCRKHGIT-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.33 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |