C19H17ClF3N3O2S — CID 112799262
2-[4-[2-chloro-5-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]-2-phenylacetonitrile (PubChem CID 112799262) has the molecular formula C19H17ClF3N3O2S and a molecular weight of 443.88 g/mol. Its IUPAC name is 2-[4-[2-chloro-5-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]-2-phenylacetonitrile.
| Compound Name | 2-[4-[2-chloro-5-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]-2-phenylacetonitrile |
|---|---|
| PubChem CID | 112799262 |
| Molecular Formula | C19H17ClF3N3O2S |
| Molecular Weight | 443.88 g/mol |
| Exact Mass | 443.07 |
| IUPAC Name | 2-[4-[2-chloro-5-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]-2-phenylacetonitrile |
| SMILES | N#CC(c1ccccc1)N1CCN(S(=O)(=O)c2cc(C(F)(F)F)ccc2Cl)CC1 |
| InChI | InChI=1S/C19H17ClF3N3O2S/c20-16-7-6-15(19(21,22)23)12-18(16)29(27,28)26-10-8-25(9-11-26)17(13-24)14-4-2-1-3-5-14/h1-7,12,17H,8-11H2 |
| InChIKey | BUHOXEHEDBQUPS-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.88 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |