C16H18BrN3O2S — CID 29352331
1-(3-bromophenyl)sulfonyl-4-(pyridin-4-ylmethyl)piperazine (PubChem CID 29352331) has the molecular formula C16H18BrN3O2S and a molecular weight of 396.31 g/mol. Its IUPAC name is 1-(3-bromophenyl)sulfonyl-4-(pyridin-4-ylmethyl)piperazine.
| Compound Name | 1-(3-bromophenyl)sulfonyl-4-(pyridin-4-ylmethyl)piperazine |
|---|---|
| PubChem CID | 29352331 |
| Molecular Formula | C16H18BrN3O2S |
| Molecular Weight | 396.31 g/mol |
| Exact Mass | 395.03 |
| IUPAC Name | 1-(3-bromophenyl)sulfonyl-4-(pyridin-4-ylmethyl)piperazine |
| SMILES | O=S(=O)(c1cccc(Br)c1)N1CCN(Cc2ccncc2)CC1 |
| InChI | InChI=1S/C16H18BrN3O2S/c17-15-2-1-3-16(12-15)23(21,22)20-10-8-19(9-11-20)13-14-4-6-18-7-5-14/h1-7,12H,8-11,13H2 |
| InChIKey | AAKNBOYMONILNI-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.31 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |