C20H27N4O3+ — CID 9325781
1-[[(4S)-4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl]methyl]-N-phenylpiperidin-1-ium-4-carboxamide (PubChem CID 9325781) has the molecular formula C20H27N4O3+ and a molecular weight of 371.46 g/mol. Its IUPAC name is 1-[[(4S)-4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl]methyl]-N-phenylpiperidin-1-ium-4-carboxamide.
| Compound Name | 1-[[(4S)-4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl]methyl]-N-phenylpiperidin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 9325781 |
| Molecular Formula | C20H27N4O3+ |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | 1-[[(4S)-4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl]methyl]-N-phenylpiperidin-1-ium-4-carboxamide |
| SMILES | C[C@@]1(C2CC2)NC(=O)N(C[NH+]2CCC(C(=O)Nc3ccccc3)CC2)C1=O |
| InChI | InChI=1S/C20H26N4O3/c1-20(15-7-8-15)18(26)24(19(27)22-20)13-23-11-9-14(10-12-23)17(25)21-16-5-3-2-4-6-16/h2-6,14-15H,7-13H2,1H3,(H,21,25)(H,22,27)/p+1/t20-/m0/s1 |
| InChIKey | BAXRVELGYWJYLO-FQEVSTJZSA-O |
| XLogP | 0.60 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|