C22H30N5O4+ — CID 9134484
1-[2-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl]-N-phenylpiperidin-1-ium-4-carboxamide (PubChem CID 9134484) has the molecular formula C22H30N5O4+ and a molecular weight of 428.51 g/mol. Its IUPAC name is 1-[2-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl]-N-phenylpiperidin-1-ium-4-carboxamide.
| Compound Name | 1-[2-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl]-N-phenylpiperidin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 9134484 |
| Molecular Formula | C22H30N5O4+ |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | 1-[2-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl]-N-phenylpiperidin-1-ium-4-carboxamide |
| SMILES | O=C(C[NH+]1CCC(C(=O)Nc2ccccc2)CC1)NN1C(=O)NC2(CCCCC2)C1=O |
| InChI | InChI=1S/C22H29N5O4/c28-18(25-27-20(30)22(24-21(27)31)11-5-2-6-12-22)15-26-13-9-16(10-14-26)19(29)23-17-7-3-1-4-8-17/h1,3-4,7-8,16H,2,5-6,9-15H2,(H,23,29)(H,24,31)(H,25,28)/p+1 |
| InChIKey | QBAGAXPAGQVOJA-UHFFFAOYSA-O |
| XLogP | 0.21 |
| TPSA | 112.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|