C22H29N4O3+ — CID 8754038
N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-(4-phenyl-1,2,3,6-tetrahydropyridin-1-ium-1-yl)acetamide (PubChem CID 8754038) has the molecular formula C22H29N4O3+ and a molecular weight of 397.50 g/mol. Its IUPAC name is N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-(4-phenyl-1,2,3,6-tetrahydropyridin-1-ium-1-yl)acetamide.
| Compound Name | N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-(4-phenyl-1,2,3,6-tetrahydropyridin-1-ium-1-yl)acetamide |
|---|---|
| PubChem CID | 8754038 |
| Molecular Formula | C22H29N4O3+ |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-(4-phenyl-1,2,3,6-tetrahydropyridin-1-ium-1-yl)acetamide |
| SMILES | CC1CCC2(CC1)NC(=O)N(NC(=O)C[NH+]1CC=C(c3ccccc3)CC1)C2=O |
| InChI | InChI=1S/C22H28N4O3/c1-16-7-11-22(12-8-16)20(28)26(21(29)23-22)24-19(27)15-25-13-9-18(10-14-25)17-5-3-2-4-6-17/h2-6,9,16H,7-8,10-15H2,1H3,(H,23,29)(H,24,27)/p+1 |
| InChIKey | WQLPRLGYDNTZHR-UHFFFAOYSA-O |
| XLogP | 0.89 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|