C24H29N4O3+ — CID 8596083
benzhydryl-[2-[(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl]azanium (PubChem CID 8596083) has the molecular formula C24H29N4O3+ and a molecular weight of 421.52 g/mol. Its IUPAC name is benzhydryl-[2-[(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl]azanium.
| Compound Name | benzhydryl-[2-[(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 8596083 |
| Molecular Formula | C24H29N4O3+ |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | benzhydryl-[2-[(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl]azanium |
| SMILES | CC1CCC2(CC1)NC(=O)N(NC(=O)C[NH2+]C(c1ccccc1)c1ccccc1)C2=O |
| InChI | InChI=1S/C24H28N4O3/c1-17-12-14-24(15-13-17)22(30)28(23(31)26-24)27-20(29)16-25-21(18-8-4-2-5-9-18)19-10-6-3-7-11-19/h2-11,17,21,25H,12-16H2,1H3,(H,26,31)(H,27,29)/p+1 |
| InChIKey | SGTQWBZGOBDYFG-UHFFFAOYSA-O |
| XLogP | 1.87 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|