C20H26N4O7S — CID 55326752
[2-[(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] 2-(benzenesulfonamido)propanoate (PubChem CID 55326752) has the molecular formula C20H26N4O7S and a molecular weight of 466.52 g/mol. Its IUPAC name is [2-[(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] 2-(benzenesulfonamido)propanoate.
| Compound Name | [2-[(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] 2-(benzenesulfonamido)propanoate |
|---|---|
| PubChem CID | 55326752 |
| Molecular Formula | C20H26N4O7S |
| Molecular Weight | 466.52 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | [2-[(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] 2-(benzenesulfonamido)propanoate |
| SMILES | CC1CCC2(CC1)NC(=O)N(NC(=O)COC(=O)C(C)NS(=O)(=O)c1ccccc1)C2=O |
| InChI | InChI=1S/C20H26N4O7S/c1-13-8-10-20(11-9-13)18(27)24(19(28)21-20)22-16(25)12-31-17(26)14(2)23-32(29,30)15-6-4-3-5-7-15/h3-7,13-14,23H,8-12H2,1-2H3,(H,21,28)(H,22,25) |
| InChIKey | PJWHGSLRMZUFPE-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 150.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.52 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|