C18H19Cl2N3O5 — CID 16523121
[2-[(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] 2,3-dichlorobenzoate (PubChem CID 16523121) has the molecular formula C18H19Cl2N3O5 and a molecular weight of 428.27 g/mol. Its IUPAC name is [2-[(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] 2,3-dichlorobenzoate.
| Compound Name | [2-[(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] 2,3-dichlorobenzoate |
|---|---|
| PubChem CID | 16523121 |
| Molecular Formula | C18H19Cl2N3O5 |
| Molecular Weight | 428.27 g/mol |
| Exact Mass | 427.07 |
| IUPAC Name | [2-[(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] 2,3-dichlorobenzoate |
| SMILES | CC1CCC2(CC1)NC(=O)N(NC(=O)COC(=O)c1cccc(Cl)c1Cl)C2=O |
| InChI | InChI=1S/C18H19Cl2N3O5/c1-10-5-7-18(8-6-10)16(26)23(17(27)21-18)22-13(24)9-28-15(25)11-3-2-4-12(19)14(11)20/h2-4,10H,5-9H2,1H3,(H,21,27)(H,22,24) |
| InChIKey | DTJRKVYLEQGVHF-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.27 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|