C19H23N3O6 — CID 7840553
[2-[(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] 2-hydroxy-3-methylbenzoate (PubChem CID 7840553) has the molecular formula C19H23N3O6 and a molecular weight of 389.41 g/mol. Its IUPAC name is [2-[(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] 2-hydroxy-3-methylbenzoate.
| Compound Name | [2-[(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] 2-hydroxy-3-methylbenzoate |
|---|---|
| PubChem CID | 7840553 |
| Molecular Formula | C19H23N3O6 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | [2-[(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] 2-hydroxy-3-methylbenzoate |
| SMILES | Cc1cccc(C(=O)OCC(=O)NN2C(=O)NC3(CCC(C)CC3)C2=O)c1O |
| InChI | InChI=1S/C19H23N3O6/c1-11-6-8-19(9-7-11)17(26)22(18(27)20-19)21-14(23)10-28-16(25)13-5-3-4-12(2)15(13)24/h3-5,11,24H,6-10H2,1-2H3,(H,20,27)(H,21,23) |
| InChIKey | STNHDYKTEFHMEG-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|